
CAS 1341870-17-4
:2-(1,1-Dimethylethyl)-1-(2-methylpropyl)piperazine
Description:
2-(1,1-Dimethylethyl)-1-(2-methylpropyl)piperazine is an organic compound characterized by its piperazine backbone, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl group (1,1-dimethylethyl) and an isobutyl group (2-methylpropyl) attached to the piperazine, contributing to its unique structural and chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the bulky tert-butyl and isobutyl groups can influence its steric hindrance, potentially affecting its reactivity and interactions with other molecules. This compound may exhibit basic properties due to the nitrogen atoms in the piperazine ring, making it capable of forming salts with acids. Its applications could span various fields, including pharmaceuticals and agrochemicals, where it may serve as an intermediate or a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H26N2
InChI:InChI=1S/C12H26N2/c1-10(2)9-14-7-6-13-8-11(14)12(3,4)5/h10-11,13H,6-9H2,1-5H3
InChI key:InChIKey=FQQCAKKOPAQACJ-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1N(CC(C)C)CCNC1
Synonyms:- Piperazine, 2-(1,1-dimethylethyl)-1-(2-methylpropyl)-
- 2-(1,1-Dimethylethyl)-1-(2-methylpropyl)piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.