CymitQuimica logo

CAS 1342160-29-5

:

N-(2-Chlorophenyl)tetrahydro-2H-thiopyran-3-amine

Description:
N-(2-Chlorophenyl)tetrahydro-2H-thiopyran-3-amine is a chemical compound characterized by its unique structure, which includes a tetrahydrothiopyran ring and an amine functional group. The presence of a 2-chlorophenyl substituent indicates that the compound has a chlorine atom attached to a phenyl ring, which can influence its reactivity and biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. The tetrahydrothiopyran moiety contributes to its potential as a pharmacophore in medicinal chemistry, possibly offering interesting interactions with biological targets. Additionally, the chlorine substituent may enhance lipophilicity, impacting the compound's absorption and distribution in biological systems. Overall, N-(2-Chlorophenyl)tetrahydro-2H-thiopyran-3-amine represents a class of compounds that may have applications in drug development, particularly in the search for new therapeutic agents.
Formula:C11H14ClNS
InChI:InChI=1S/C11H14ClNS/c12-10-5-1-2-6-11(10)13-9-4-3-7-14-8-9/h1-2,5-6,9,13H,3-4,7-8H2
InChI key:InChIKey=AZVDPFSUIPCMIA-UHFFFAOYSA-N
SMILES:N(C1=C(Cl)C=CC=C1)C2CCCSC2
Synonyms:
  • 2H-Thiopyran-3-amine, N-(2-chlorophenyl)tetrahydro-
  • N-(2-Chlorophenyl)tetrahydro-2H-thiopyran-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.