CAS 134220-37-4
:1-(3-CHLORO-4-FLUORO-PHENYL)-PYRROLE-2,5-DIONE
Description:
1-(3-Chloro-4-fluoro-phenyl)-pyrrole-2,5-dione, with the CAS number 134220-37-4, is a synthetic organic compound characterized by its unique structure that includes a pyrrole ring fused with a diketone moiety. The presence of a chloro and a fluoro substituent on the phenyl group contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. The halogen substituents can influence the electronic properties of the molecule, potentially enhancing its interaction with biological targets. Additionally, the compound may undergo various chemical reactions, including electrophilic substitution and nucleophilic addition, making it a versatile intermediate in organic synthesis. As with many synthetic compounds, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C10H5ClFNO2
InChI:InChI=1/C10H5ClFNO2/c11-7-5-6(1-2-8(7)12)13-9(14)3-4-10(13)15/h1-5H
SMILES:c1cc(c(cc1N1C(=O)C=CC1=O)Cl)F
Synonyms:- 1-(3-Chloro-4-fluorophenyl)-1H-pyrrole-2,5-dione
- 1-(3-Chloro-4-fluorophenyl)-2,5-dihydro-1H-pyrrole-2,5-dione
- 1H-Pyrrole-2,5-dione, 1-(3-chloro-4-fluorophenyl)-
- T5Vnvj Br Cg Df [Wln]
- 1-(3-Chloro-4-fluoro-phenyl)-pyrrole-2,5-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
