CAS 134221-53-7

4-Chloro-5-iodo-2,6-dimethoxypyrimidine

Description:

4-Chloro-5-iodo-2,6-dimethoxypyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with chlorine, iodine, and methoxy groups. The presence of the chlorine and iodine atoms introduces significant reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. The methoxy groups enhance the solubility and stability of the compound, influencing its biological activity. This compound typically appears as a crystalline solid and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological targets, which is of interest in medicinal chemistry. The specific arrangement of substituents on the pyrimidine ring can affect its electronic properties and reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Chloro-5-iodo-2,6-dimethoxypyrimidine is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₆ClIN₂O₂

InChI: InChI=1S/C6H6ClIN2O2/c1-11-5-3(8)4(7)9-6(10-5)12-2/h1-2H3

InChI key: InChIKey=XCUWJUCSKOUCEN-UHFFFAOYSA-N

SMILES: O(C)C=1C(I)=C(Cl)N=C(OC)N1

Synonyms:

• 4-Chloro-5-iodo-2,6-dimethoxypyrimidine
• Pyrimidine, 4-chloro-5-iodo-2,6-dimethoxy-
• 6-Chloro-5-iodo-2,4-dimethoxypyrimidine