CymitQuimica logo

CAS 1342216-47-0

:

N-(2-Methoxy-1-methylethyl)-4-methyl-3-pyridinamine

Description:
N-(2-Methoxy-1-methylethyl)-4-methyl-3-pyridinamine, identified by its CAS number 1342216-47-0, is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methoxy group and a branched alkyl chain, contributing to its unique properties. The presence of the amino group (-NH2) on the pyridine ring suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The methoxy group enhances its lipophilicity, potentially affecting its biological activity and interaction with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which could confer specific pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as chromatography. Understanding its behavior in various chemical environments is crucial for applications in drug development or as a research tool in biochemical studies.
Formula:C10H16N2O
InChI:InChI=1S/C10H16N2O/c1-8-4-5-11-6-10(8)12-9(2)7-13-3/h4-6,9,12H,7H2,1-3H3
InChI key:InChIKey=YLGXHZLMEKUIQG-UHFFFAOYSA-N
SMILES:N(C(COC)C)C=1C(C)=CC=NC1
Synonyms:
  • 3-Pyridinamine, N-(2-methoxy-1-methylethyl)-4-methyl-
  • N-(2-Methoxy-1-methylethyl)-4-methyl-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.