CAS 13423-60-4
:1-Phenyl-1H-1,2,4-triazole
Description:
1-Phenyl-1H-1,2,4-triazole is an organic compound characterized by its triazole ring structure, which consists of three nitrogen atoms and two carbon atoms in a five-membered ring. This compound features a phenyl group attached to the triazole, contributing to its aromatic properties. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the triazole moiety imparts unique chemical reactivity, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, 1-Phenyl-1H-1,2,4-triazole may exhibit biological activity, including antifungal and herbicidal properties, which enhances its significance in medicinal chemistry and agricultural applications. Its stability under standard conditions and the ability to form coordination complexes with metals further broaden its potential uses in materials science and catalysis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H7N3
InChI:InChI=1S/C8H7N3/c1-2-4-8(5-3-1)11-7-9-6-10-11/h1-7H
InChI key:InChIKey=CGRLXLHYYDSTKR-UHFFFAOYSA-N
SMILES:N1(C=NC=N1)C2=CC=CC=C2
Synonyms:- 1-Phenyl-1,2,4-triazole
- 1-Phenyl-1H-1,2,4-triazole
- 1-Phenyl-s-triazole
- 1H-1,2,4-Triazole, 1-phenyl-
- Brn 0116495
- N-Phenyl-1H-1,2,4-triazole
- NSC 609753
- 5-26-01-00147 (Beilstein Handbook Reference)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Phenyl-1H-1,2,4-triazole
CAS:Formula:C8H7N3Purity:98%Color and Shape:SolidMolecular weight:145.16131-Phenyl-1H-1,2,4-triazole
CAS:1-Phenyl-1H-1,2,4-triazole is a chemical compound that is used as a reagent in organic synthesis. It is a colorless to white crystalline solid that has a melting point of 127 °C. 1-Phenyl-1H-1,2,4-triazole exists in two isomers: cis and trans. The cis form is more stable than the trans form and has a melting point of 154 °C. The cis form also has higher boiling point of 275 °C and lower vapor pressure than the trans form. This chemical compound reacts easily with hydroxyalkyl groups and fluorine atoms to produce triketones. It can also react with chlorine or chloride ions to produce triazoles. 1-Phenyl-1H-1,2,4-triazole can be reacted with phenylhydrazine to produce mononuclear compounds.Formula:C8H7N3Purity:Min. 95%Molecular weight:145.17 g/mol



