CAS 134237-40-4
:Trichlorotrifluoropropane
Description:
Trichlorotrifluoropropane, with the CAS number 134237-40-4, is a synthetic chemical compound belonging to the class of chlorofluorocarbons (CFCs). It is characterized by its molecular structure, which includes three chlorine atoms and three fluorine atoms attached to a propane backbone. This compound is typically colorless and has a low boiling point, making it a gas or volatile liquid at room temperature. Trichlorotrifluoropropane is known for its stability and resistance to degradation in the atmosphere, which raises concerns regarding its potential as an ozone-depleting substance. It is primarily used in industrial applications, including as a refrigerant and solvent. Due to its environmental impact, particularly in relation to ozone layer depletion, its production and use are regulated under various international agreements, such as the Montreal Protocol. Safety considerations include its potential toxicity and the need for proper handling to avoid inhalation or skin contact. Overall, while it has useful applications, the environmental implications necessitate careful management.
Formula:C3H2Cl3F3
InChI:InChI=1/C3H2Cl3F3/c4-3(5,6)2(8,9)1-7/h1H2
SMILES:C(C(C(Cl)(Cl)Cl)(F)F)F
Synonyms:- 1,1,1-Trichloro-2,2,3-trifluoropropane
- Propane, 1,1,1-Trichloro-2,2,3-Trifluoro-
- Propane, trichlorotrifluoro-
- Trichlorotrifluoropropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.