CAS 1342382-47-1

2-Butanol, 4-[(cyclohexylmethyl)amino]-

Description:

2-Butanol, 4-[(cyclohexylmethyl)amino]- is an organic compound characterized by its structure, which includes a butanol moiety and a cyclohexylmethylamino group. This compound features a hydroxyl (-OH) functional group, which classifies it as an alcohol, contributing to its potential solubility in polar solvents. The presence of the cyclohexylmethyl group introduces hydrophobic characteristics, influencing its overall solubility and reactivity. Typically, such compounds may exhibit moderate to low volatility and can participate in hydrogen bonding due to the hydroxyl group. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, where the amine functionality may play a role in reactivity and interaction with biological systems. Additionally, the compound's properties, such as boiling point, melting point, and density, would be influenced by the balance between the hydrophilic alcohol and the hydrophobic cyclohexyl group. Overall, 2-Butanol, 4-[(cyclohexylmethyl)amino]- represents a unique combination of functional groups that can lead to diverse chemical behavior and applications.

Formula: C₁₁H₂₃NO

InChI: InChI=1S/C11H23NO/c1-10(13)7-8-12-9-11-5-3-2-4-6-11/h10-13H,2-9H2,1H3

InChI key: InChIKey=WXHVOGRJDLXPPX-UHFFFAOYSA-N

SMILES: C(NCCC(C)O)C1CCCCC1

Synonyms:

• 2-Butanol, 4-[(cyclohexylmethyl)amino]-