CAS 13425-76-8
:D-lyxo-hex-5-ulosonic acid
Description:
D-lyxo-hex-5-ulosonic acid, also known as D-lyxo-5-hexulosonic acid, is a sugar acid that is classified as an aldose and is a derivative of hexose sugars. It features a six-carbon backbone with a carboxylic acid functional group, which contributes to its acidic properties. This compound is characterized by its specific stereochemistry, which influences its biological activity and reactivity. D-lyxo-hex-5-ulosonic acid is typically found in certain metabolic pathways and can be involved in the synthesis of various biomolecules. Its structure allows it to participate in enzymatic reactions, making it relevant in biochemical studies. The compound is soluble in water, which facilitates its interactions in biological systems. Additionally, it may exhibit specific optical activity due to its chiral centers. As with many sugar acids, it can undergo various transformations, including oxidation and reduction, depending on the conditions and reagents present. Overall, D-lyxo-hex-5-ulosonic acid plays a role in carbohydrate metabolism and has potential implications in research related to glycoproteins and polysaccharides.
Formula:C6H10O7
InChI:InChI=1/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/t3-,4+,5+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
D-Lyxo-5-hexulosonic acid
CAS:<p>D-Lyxo-5-hexulosonic acid is a substrate molecule and an intermediate in the synthesis of the pentose phosphate pathway, which provides NADPH and ribose-5-phosphate for biosynthesis. D-Lyxo-5-hexulosonic acid is also involved in the biosynthesis of galacturonic acid, which is a component of bacterial cell walls. This compound was found to be an inhibitor of corrosion, but it can also act as a stabilizer in foods, pharmaceuticals, and cosmetics. D-Lyxo-5-hexulosonic acid may be used as a growth factor for cells in culture and has been shown to inhibit the replication of bacteria such as Salmonella enterica serovar Typhi.</p>Formula:C6H10O7Purity:Min. 95%Molecular weight:194.14 g/mol
