CAS 13425-93-9: 4-Hydroxy-6,7-dimethoxyqunioline
Description:4-Hydroxy-6,7-dimethoxyquinoline, identified by its CAS number 13425-93-9, is a chemical compound belonging to the quinoline family, which is characterized by a fused bicyclic structure containing a benzene ring and a pyridine ring. This compound features hydroxyl (-OH) and methoxy (-OCH3) functional groups, which contribute to its chemical reactivity and potential biological activity. The presence of these substituents can influence its solubility, polarity, and interaction with biological systems. Typically, quinoline derivatives are studied for their pharmacological properties, including antimicrobial, antimalarial, and anticancer activities. The specific arrangement of the hydroxyl and methoxy groups in 4-Hydroxy-6,7-dimethoxyquinoline may enhance its ability to form hydrogen bonds and participate in various chemical reactions. Additionally, the compound's stability, melting point, and spectral properties can be influenced by its molecular structure. Overall, this compound is of interest in both synthetic chemistry and medicinal chemistry due to its potential applications.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-14-10-5-7-8(6-11(10)15-2)12-4-3-9(7)13/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=QOGPNCUTXVZQSL-UHFFFAOYSA-N
SMILES:OC=1C=CN=C2C=C(OC)C(OC)=CC12
- Synonyms:
- 4-Hydroxy-6,7-Dimethoxyquinoline
- 4-Quinolinol, 6,7-dimethoxy-
- 6,7-Dimethoxy-4-hydroxyquinoline
- 6,7-Dimethoxy-4-quinolinol
- 6,7-Dimethoxy-Quinolin-4-Ol
- 6,7-Dimethoxyquinolin-4(1H)-One
- See more synonyms
