CAS 134275-16-4

1-(Phenylmethyl)-2-(trifluoromethyl)-1H-benzimidazole

Description:

1-(Phenylmethyl)-2-(trifluoromethyl)-1H-benzimidazole, with the CAS number 134275-16-4, is a chemical compound that belongs to the class of benzimidazoles, which are bicyclic compounds featuring a fused benzene and imidazole ring. This particular compound is characterized by the presence of a phenylmethyl group and a trifluoromethyl group, which significantly influence its chemical properties and reactivity. The trifluoromethyl group is known for imparting lipophilicity and enhancing metabolic stability, while the phenylmethyl moiety can contribute to the compound's ability to interact with biological targets. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structure suggests potential applications in drug development, particularly in areas targeting specific biological pathways. Additionally, the presence of fluorine atoms can enhance the compound's binding affinity and selectivity towards certain receptors or enzymes. Overall, this compound's unique structural features may lead to diverse applications in pharmaceuticals and agrochemicals.

Formula: C₁₅H₁₁F₃N₂

InChI: InChI=1S/C15H11F3N2/c16-15(17,18)14-19-12-8-4-5-9-13(12)20(14)10-11-6-2-1-3-7-11/h1-9H,10H2

InChI key: InChIKey=IESKMPWSWRXZGZ-UHFFFAOYSA-N

SMILES: C(N1C=2C(N=C1C(F)(F)F)=CC=CC2)C3=CC=CC=C3

Synonyms:

• 1-Benzyl-2-(trifluoromethyl)benzimidazole
• 1-Benzyl-2-(trifluoromethyl)-1H-1,3-benzodiazole
• 1-Benzyl-2-trifluoromethyl-1H-benzoimidazole
• 1-(Phenylmethyl)-2-(trifluoromethyl)-1H-benzimidazole
• 1H-Benzimidazole, 1-(phenylmethyl)-2-(trifluoromethyl)-

1-Benzyl-2-(trifluoromethyl)-1H-1,3-benzimidazole

Controlled Product

CAS: 134275-16-4

Versatile small molecule scaffold

Formula: C₁₅H₁₁F₃N₂

Purity: Min. 95%

Molecular weight: 276.26 g/mol

Ref: 3D-JFA27516