CAS 13428-22-3
:2-(1,3,4-oxadiazol-2-yl)pyridine
Description:
2-(1,3,4-Oxadiazol-2-yl)pyridine is a heterocyclic compound characterized by the presence of both a pyridine ring and an oxadiazole moiety. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activities, including antimicrobial and antifungal properties, making it of interest in medicinal chemistry. The oxadiazole ring contributes to its stability and reactivity, while the pyridine nitrogen can participate in hydrogen bonding and coordination with metal ions. The compound is generally soluble in polar organic solvents, which enhances its applicability in various chemical reactions and formulations. Its unique structure allows for diverse functionalization, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the presence of both nitrogen-containing rings may influence its electronic properties, potentially leading to interesting photophysical behaviors. Overall, 2-(1,3,4-oxadiazol-2-yl)pyridine is a versatile compound with significant implications in both research and industrial applications.
Formula:C7H5N3O
InChI:InChI=1/C7H5N3O/c1-2-4-8-6(3-1)7-10-9-5-11-7/h1-5H
SMILES:c1ccnc(c1)c1nnco1
Synonyms:- Pyridine, 2- (1,3,4-oxadiazol-2-yl)-
- 2-(Pyridin-2-Yl)-1,3,4-Oxadiazole
- 2-(1,3,4-Oxadiazol-2-yl)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(1,3,4-Oxadiazol-2-yl)pyridine
CAS:<p>2-(1,3,4-Oxadiazol-2-yl)pyridine is a compound that has been shown to have anticancer activity. It reacts with carbonyl groups in tissues and may modify the cell membrane by adding or removing functional groups. 2-(1,3,4-Oxadiazol-2-yl)pyridine also interacts with positron emitters and is able to be detected using a positron emission tomography scan. This compound has been found in human ganglia and can interact with acetylcholine receptors. The molecule was expressed in the human brain and changes in its expression levels have been correlated with cognitive function. 2-(1,3,4-Oxadiazol-2-yl)pyridine interacts with cholinergic receptors and has been shown to affect cellular processes such as protein synthesis. Pairwise energy calculations have revealed that this molecule will not bind to other molecules due to steric hindrance.</p>Formula:C7H5N3OPurity:Min. 95%Molecular weight:147.13 g/mol
