
CAS 134283-49-1
:[C(E)]-4-Hydroxy-3-methoxybenzaldehyde oxime
Description:
[C(E)]-4-Hydroxy-3-methoxybenzaldehyde oxime, with the CAS number 134283-49-1, is an organic compound characterized by its functional groups, including a hydroxyl group (-OH), a methoxy group (-OCH3), and an oxime group (-C=N-OH). This compound features a benzaldehyde backbone, which contributes to its aromatic properties. The presence of the hydroxyl and methoxy groups enhances its solubility in polar solvents and may influence its reactivity, particularly in nucleophilic addition reactions. The oxime functionality indicates potential applications in organic synthesis, particularly in the formation of amines or as intermediates in various chemical reactions. Additionally, compounds with similar structures often exhibit biological activity, making them of interest in medicinal chemistry. The stability of the oxime group under various conditions can vary, and its reactivity can be influenced by the surrounding substituents on the aromatic ring. Overall, [C(E)]-4-Hydroxy-3-methoxybenzaldehyde oxime is a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-12-8-4-6(5-9-11)2-3-7(8)10/h2-5,10-11H,1H3/b9-5+
InChI key:InChIKey=RJJVVYVLHWMYAA-WEVVVXLNSA-N
SMILES:O(C)C1=CC(/C=N/O)=CC=C1O
Synonyms:- Benzaldehyde, 4-hydroxy-3-methoxy-, oxime, (E)-
- [C(E)]-4-Hydroxy-3-methoxybenzaldehyde oxime
- Benzaldehyde, 4-hydroxy-3-methoxy-, oxime, [C(E)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
