CAS 134302-31-1

1-Methyl-2-nitro-4-(perfluoroethyl)benzene

Description:

1-Methyl-2-nitro-4-(perfluoroethyl)benzene, with the CAS number 134302-31-1, is an organic compound characterized by its aromatic structure, which includes a methyl group, a nitro group, and a perfluoroethyl substituent on a benzene ring. The presence of the nitro group introduces significant polarity and potential reactivity, while the perfluoroethyl group contributes to the compound's hydrophobicity and stability due to the strong carbon-fluorine bonds. This compound is likely to exhibit unique physical properties, such as a high boiling point and low solubility in water, owing to the fluorinated moiety. Additionally, the aromatic nature of the benzene ring suggests that it may participate in electrophilic substitution reactions. Its applications could span various fields, including materials science and organic synthesis, particularly in the development of fluorinated compounds. However, the environmental and health impacts of such fluorinated compounds should be considered, as they may exhibit persistence and bioaccumulation in ecosystems.

Formula: C₉H₆F₅NO₂

InChI: InChI=1/C9H6F5NO2/c1-5-2-3-6(4-7(5)15(16)17)8(10,11)9(12,13)14/h2-4H,1H3

SMILES: Cc1ccc(cc1N(=O)=O)C(C(F)(F)F)(F)F

Synonyms:

• Benzene, 1-methyl-2-nitro-4-(1,1,2,2,2-pentafluoroethyl)-
• 1-Methyl-2-Nitro-4-(1,1,2,2,2-Pentafluoroethyl)Benzene