CAS 1343057-72-6
:N-Methyl-1-(2-methylpropyl)-1H-pyrazole-4-propanamine
Description:
N-Methyl-1-(2-methylpropyl)-1H-pyrazole-4-propanamine is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with a methyl group and a propanamine side chain. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of the pyrazole moiety may impart specific biological activities, making it of interest in pharmaceutical research. Additionally, the branched alkyl group (2-methylpropyl) can affect the compound's steric properties and lipophilicity, potentially influencing its interaction with biological targets. The compound's molecular weight, melting point, boiling point, and other physical properties would need to be determined experimentally or sourced from reliable databases. Safety data, including toxicity and handling precautions, should also be consulted, as these factors are crucial for any practical applications or research involving this substance.
Formula:C11H21N3
InChI:InChI=1S/C11H21N3/c1-10(2)8-14-9-11(7-13-14)5-4-6-12-3/h7,9-10,12H,4-6,8H2,1-3H3
InChI key:InChIKey=XZEWCSKVEFLFQP-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C=C(CCCNC)C=N1
Synonyms:- N-Methyl-1-(2-methylpropyl)-1H-pyrazole-4-propanamine
- 1H-Pyrazole-4-propanamine, N-methyl-1-(2-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.