CymitQuimica logo

CAS 134309-86-7

:

S-A-hydroxymethyl tyrosine

Description:
S-A-hydroxymethyl tyrosine, identified by its CAS number 134309-86-7, is a derivative of the amino acid tyrosine, characterized by the presence of a hydroxymethyl group at the sulfur atom of the side chain. This modification can influence its biochemical properties and interactions. The compound is typically involved in various biochemical pathways and may serve as a precursor or intermediate in the synthesis of other biologically relevant molecules. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic disorders. The presence of the hydroxymethyl group can enhance solubility and reactivity, making it a subject of interest in research focused on drug design and synthesis. Additionally, S-A-hydroxymethyl tyrosine may exhibit specific interactions with enzymes or receptors, contributing to its biological activity. As with many amino acid derivatives, its stability, solubility, and reactivity can vary depending on environmental conditions such as pH and temperature.
Formula:C10H13NO4
InChI:InChI=1/C10H13NO4/c11-10(6-12,9(14)15)5-7-1-3-8(13)4-2-7/h1-4,12-13H,5-6,11H2,(H,14,15)/t10-/m0/s1
SMILES:c1cc(ccc1C[C@](CO)(C(=O)O)N)O
Synonyms:
  • α-(hydroxymethyl)-D-tyrosine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • α-Hydroxymethyl-D-tyrosine

    Controlled Product
    CAS:
    Formula:C10H13NO4
    Color and Shape:Neat
    Molecular weight:211.214

    Ref: TR-H825495

    500mg
    10,511.00€