CAS 13431-10-2
:1-Methyl-2-imidazolidinethione
Description:
1-Methyl-2-imidazolidinethione is a heterocyclic organic compound characterized by its imidazolidine ring structure, which contains a sulfur atom and a methyl group. This compound features a five-membered ring with two nitrogen atoms and one sulfur atom, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid and is soluble in polar solvents. The presence of the thione functional group (–C=S) imparts distinct reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. 1-Methyl-2-imidazolidinethione may exhibit biological activity, making it of interest in pharmaceutical and agricultural applications. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many sulfur-containing compounds, it may also have a characteristic odor. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly. Overall, this compound is significant in both synthetic chemistry and potential applications in various fields.
Formula:C4H8N2S
InChI:InChI=1/C4H8N2S/c1-6-3-2-5-4(6)7/h2-3H2,1H3,(H,5,7)
Synonyms:- Timtec-Bb Sbb007579
- Tapazole
- Labotest-Bb Lt00033517
- Methimazol
- Methiazole
- 1,3-Dihydro-1-Methyl-2H-Imidazol-2-Thione
- 1-Methylimidazolidine-2-Thione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Imidazolidinethione, 1-methyl-
CAS:Formula:C4H8N2SPurity:98%Color and Shape:SolidMolecular weight:116.18471-Methylimidazolidine-2-thione
CAS:<p>1-Methylimidazolidine-2-thione</p>Formula:C4H8N2SPurity:98%Color and Shape: yellow crystalline powderMolecular weight:116.18g/mol1-Methylimidazolidine-2-thione
CAS:Controlled ProductFormula:C4H8N2SColor and Shape:NeatMolecular weight:116.185



