CAS 134332-50-6
:Galanthamine-N-oxide
Description:
Galanthamine-N-oxide is a chemical compound derived from galanthamine, which is an alkaloid primarily extracted from plants of the Amaryllidaceae family. This substance is characterized by its structural modification, where an N-oxide functional group is introduced, enhancing its pharmacological properties. Galanthamine-N-oxide exhibits potential as a reversible inhibitor of acetylcholinesterase, an enzyme that breaks down the neurotransmitter acetylcholine, thereby increasing its availability in the synaptic cleft. This mechanism suggests potential applications in treating neurodegenerative diseases, such as Alzheimer's disease. The compound is typically a white to off-white solid and is soluble in polar solvents. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Additionally, research into its pharmacokinetics and toxicity profiles is ongoing, as understanding these characteristics is crucial for its therapeutic use. Overall, Galanthamine-N-oxide represents a significant area of interest in medicinal chemistry due to its neuroprotective effects and potential therapeutic applications.
Formula:C17H21NO4
InChI:InChI=1/C17H21NO4/c1-18(20)8-7-17-6-5-12(19)9-14(17)22-16-13(21-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-,18?/m0/s1
SMILES:CN1(=O)CC[C@@]23C=C[C@@H](C[C@@H]2Oc2c(ccc(C1)c32)OC)O
Synonyms:- (4aS,6R,8aS,11R)-4a,5,9,10,11,12-Hexahydro-3-methoxy-11-methyl-6H-benzofuro[3a,3,2-ef][2]benzazepin-6-ol 11-Oxide
- Galanthamine 10-Oxide
- (4aS,6R,8aS)-3-methoxy-11-methyl-5,6,9,10,11,12-hexahydro-4aH-[1]benzofuro[3a,3,2-ef][2]benzazepin-6-ol 11-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Galanthamine N-Oxide
CAS:Galanthamine N-Oxide: EC50 26.2 μM for eel AChE inhibition; blocks active sites in Tc/hAChE/hBChE; derived from Zephyranthes concolor bulbs.Formula:C17H21NO4Purity:99.29%Color and Shape:SolidMolecular weight:303.35Galanthamine N-Oxide
CAS:Controlled ProductStability Hygroscopic
Applications A metabolite of Galanthamine (G188500), a selective acetylcholinesterase inhibitor.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Bickel, U., et al.: Clin. Pharmacol. Ther., 50, 420 (1991), Mannens, G., et al.: Drug Metab. Dispos., 30, 553 (2002), Zhao, Q., et al.: J. Clin. Pharmacol., 42, 428 (2002), Geerts, H., et al.: Brain Res., 1033, 186 (2005),Formula:C17H21NO4Color and Shape:NeatMolecular weight:303.35Galanthamine N-oxide
CAS:Controlled ProductMetabolite of galanthamineFormula:C17H21NO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:303.35 g/mol







