CAS 134332-63-1
:phenoxan
Description:
Phenoxan, with the CAS number 134332-63-1, is a chemical compound that belongs to the class of phenothiazine derivatives. It is characterized by its unique structure, which includes a phenothiazine core, contributing to its potential biological activity. Phenoxan is often studied for its applications in medicinal chemistry, particularly for its antitumor and antimicrobial properties. The compound exhibits moderate solubility in organic solvents, which can influence its bioavailability and efficacy in various formulations. Additionally, phenoxan may interact with biological targets, leading to various pharmacological effects. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many chemical substances, safety considerations are paramount, and handling should be conducted with appropriate precautions to mitigate any potential hazards. Overall, phenoxan represents a compound of interest in both research and therapeutic contexts, warranting further investigation into its mechanisms of action and potential applications.
Formula:C23H25NO4
InChI:InChI=1/C23H25NO4/c1-5-18-21(25)16(3)23(26-4)28-22(18)19-14-27-20(24-19)12-11-15(2)13-17-9-7-6-8-10-17/h6-10,13-14H,5,11-12H2,1-4H3/b15-13+
Synonyms:- 4H-Pyran-4-one, 3-ethyl-6-methoxy-5-methyl-2-(2-((3E)-3-methyl-4-phenyl-3-butenyl)-4-oxazolyl)-
- 3-Ethyl-6-methoxy-5-methyl-2-(2-((3E)-3-methyl-4-phenyl-3-butenyl)-4-oxazolyl)-4H-pyran-4-one
- 3-ethyl-6-methoxy-5-methyl-2-{2-[(3E)-3-methyl-4-phenylbut-3-en-1-yl]-1,3-oxazol-4-yl}-4H-pyran-4-one
- 4H-Pyran-4-one, 3-ethyl-6-methoxy-5-methyl-2-(2-(3-methyl-4-phenyl-3-butenyl)-4-oxazolyl)-, (E)-
- NSC 650914
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phenoxan
CAS:Phenoxan is isolated from Polyangium; inhibits electron transport at NADH-ubiquinone oxidoreductase.Formula:C23H25NO4Color and Shape:SolidMolecular weight:379.45
