![<span class="text-smallcaps">L</smallcap>-Valyl-N-[4-(hydroxymethyl)phenyl]-<smallcap>L</span>-ala…](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F405020-val-ala-pab.webp&w=3840&q=75)
CAS 1343476-44-7
:<span class="text-smallcaps">L</smallcap>-Valyl-N-[4-(hydroxymethyl)phenyl]-<smallcap>L</span>-alaninamide
Description:
L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide is a synthetic compound that belongs to the class of amino acid derivatives. It features a valine and alanine backbone, which are both essential amino acids, contributing to its biological relevance. The presence of a hydroxymethylphenyl group enhances its potential for interactions with biological targets, possibly influencing its pharmacological properties. This compound may exhibit characteristics such as solubility in polar solvents due to its amino acid structure, and it may participate in hydrogen bonding due to the presence of amine and hydroxyl functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of peptide-based therapeutics or as a building block for more complex molecules. However, specific biological activity, toxicity, and stability data would require further investigation through experimental studies. As with many synthetic compounds, understanding its behavior in biological systems is crucial for assessing its utility in research or therapeutic contexts.
Formula:C15H23N3O3
InChI:InChI=1S/C15H23N3O3/c1-9(2)13(16)15(21)17-10(3)14(20)18-12-6-4-11(8-19)5-7-12/h4-7,9-10,13,19H,8,16H2,1-3H3,(H,17,21)(H,18,20)/t10-,13-/m0/s1
InChI key:InChIKey=NNWYWNRCBPYLML-GWCFXTLKSA-N
SMILES:N(C([C@@H](NC([C@H](C(C)C)N)=O)C)=O)C1=CC=C(CO)C=C1
Synonyms:- 2: PN: WO2023061224 PAGE: 34 claimed sequence
- L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide
- L-Alaninamide, L-valyl-N-[4-(hydroxymethyl)phenyl]-
- CS-2747
- (S)-2-Amino-N-((S)-1-((4-(hydroxymethyl)phenyl)amino)-1-oxopropan-2-yl)-3-methylbutanamide
- Val-Ala-PAB
- Val-Ala-PAB-OH
- (2S)-2-amino-N-[(2S)-1-[4-(hydroxymethyl)anilino]-1-oxopropan-2-yl]-3-methylbutanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide
CAS:L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamidePurity:97%Molecular weight:293.37g/molVal-Ala-PAB
CAS:<p>Val-Ala-PAB: Synthesis block for Tesirine/Sg3249, an anticancer antibody-drug conjugate payload.</p>Formula:C15H23N3O3Purity:98.07%Color and Shape:SolidMolecular weight:293.36Val-Ala-PAB
CAS:Controlled Product<p>Applications Val-Ala-PAB is a building block in the synthesis of Tesirine (a.k.a. SG3249), a clinical antibody-drug conjugate pyrrolobenzodiazepine dimer payload. Reagent in the preparation of pyrrolobenzodiazepine dimers and their antibody conjugates containing peptide linkers useful for treating proliferative including cancer.<br>References Dimasi, N., et al.: Mol. Pharm., 14, 1501 (2017); Howard, P. W., et al.: PCT Int. Appl. (2011), WO 2011130598 A1 20111020<br></p>Formula:C15H23N3O3Color and Shape:NeatMolecular weight:293.36Val-Ala-PAB
CAS:<p>Val-Ala-PAB is an analog of a naturally occurring peptide that has been shown to have anticancer properties. It induces apoptosis in cancer cells by inhibiting cyclin-dependent kinases, which are proteins that regulate cell division. Val-Ala-PAB has been shown to be effective against various types of tumors, including human and Chinese hamster ovary cells. This compound is also a potent inhibitor of the proteasome, which is a cellular complex that degrades proteins. It has been found in urine samples from patients with cancer, suggesting that it may play a role in the body's natural defense against cancer. Overall, Val-Ala-PAB holds great promise as a potential cancer treatment and inhibitor of tumor growth.</p>Formula:C15H23N3O3Purity:Min. 95%Molecular weight:293.36 g/mol
![L-Valyl-N-[4-(hydroxymethyl)phenyl]-L-alaninamide](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F54%2Fthumb%2FOR97989.jpg&w=3840&q=75)
