CAS 134355-31-0
:methylidopyranosiduronic acid
Description:
Methylidopyranosiduronic acid is a chemical compound characterized by its unique structure, which includes a pyranose ring and a uronic acid functional group. This compound typically exhibits properties associated with sugars and sugar acids, such as solubility in water due to the presence of hydroxyl groups. The uronic acid component suggests that it may participate in various biochemical processes, including those related to polysaccharide metabolism and cell signaling. Methylidopyranosiduronic acid may also exhibit biological activity, potentially influencing cellular functions or interactions. Its specific applications could be relevant in fields such as biochemistry, pharmacology, or materials science, particularly in the development of glycosylated compounds or as a building block in synthetic chemistry. The compound's stability, reactivity, and interactions with other molecules would depend on its functional groups and overall molecular structure, making it a subject of interest for further research in both synthetic and natural product chemistry.
Formula:C7H11NaO7
InChI:InChI=1/C7H12O7.Na/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12;/h2-5,7-10H,1H3,(H,11,12);/q;+1/p-1/t2-,3-,4+,5+,7+;/m0./s1
SMILES:COC1C(C(C(C(C(=O)O)O1)O)O)O.[Na]
Synonyms:- Mipua
- Methyl-alpha-L-idopyranosiduronic acid
- sodium (2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxytetrahydro-2H-pyran-2-carboxylate (non-preferred name)
- Methylidopyranosiduronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl α-L-idopyranosiduronic acid sodium
CAS:Methyl a-L-idopyranosiduronic acid sodium salt is an impedance sensor that has been developed for use in electroanalytic research. The sensor consists of a monolayer of mammalian cells that are grown on a microfabricated substrate and visualized using microscopy. Methyl a-L-idopyranosiduronic acid sodium salt is used to measure the biophysical properties of muscle cells, such as their phenotype, by measuring the electrical resistance of the cell membrane. This can be used to characterize muscle disorders and identify new drug targets for regenerative medicine.Formula:C7H12O7•NaPurity:Min. 95 Area-%Color and Shape:SolidMolecular weight:231.15 g/molMethyl alpha-L-Idopyranosiduronic Acid Sodium Salt
CAS:Controlled ProductApplications An L-iduronic acid derivative.
References Forster, M.J. , et al.: J. Computational Chem., 15, 155 (1994),Formula:C7H11O7·NaColor and Shape:NeatMolecular weight:230.148


