CAS 134355-31-0

methylidopyranosiduronic acid

Description:

Methylidopyranosiduronic acid is a chemical compound characterized by its unique structure, which includes a pyranose ring and a uronic acid functional group. This compound typically exhibits properties associated with sugars and sugar acids, such as solubility in water due to the presence of hydroxyl groups. The uronic acid component suggests that it may participate in various biochemical processes, including those related to polysaccharide metabolism and cell signaling. Methylidopyranosiduronic acid may also exhibit biological activity, potentially influencing cellular functions or interactions. Its specific applications could be relevant in fields such as biochemistry, pharmacology, or materials science, particularly in the development of glycosylated compounds or as a building block in synthetic chemistry. The compound's stability, reactivity, and interactions with other molecules would depend on its functional groups and overall molecular structure, making it a subject of interest for further research in both synthetic and natural product chemistry.

Formula: C₇H₁₁NaO₇

InChI: InChI=1/C7H12O7.Na/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12;/h2-5,7-10H,1H3,(H,11,12);/q;+1/p-1/t2-,3-,4+,5+,7+;/m0./s1

SMILES: COC1C(C(C(C(C(=O)O)O1)O)O)O.[Na]

Synonyms:

• Mipua
• Methyl-alpha-L-idopyranosiduronic acid
• sodium (2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-methoxytetrahydro-2H-pyran-2-carboxylate (non-preferred name)
• Methylidopyranosiduronic acid

Methyl α-L-Idopyranosiduronic acid sodium salt

CAS: 134355-31-0

Molecular weight: 230.15

Ref: 7W-GC6046

Methyl α-L-idopyranosiduronic acid sodium

CAS: 134355-31-0

Methyl a-L-idopyranosiduronic acid sodium salt is an impedance sensor that has been developed for use in electroanalytic research. The sensor consists of a monolayer of mammalian cells that are grown on a microfabricated substrate and visualized using microscopy. Methyl a-L-idopyranosiduronic acid sodium salt is used to measure the biophysical properties of muscle cells, such as their phenotype, by measuring the electrical resistance of the cell membrane. This can be used to characterize muscle disorders and identify new drug targets for regenerative medicine.

Formula: C₇H₁₂O₇•Na

Purity: Min. 95 Area-%

Color and Shape: Solid

Molecular weight: 231.15 g/mol

Ref: 3D-MM10711

Methyl α-L-Idopyranosiduronic Acid Sodium Salt

Controlled Product

CAS: 134355-31-0

Applications An L-iduronic acid derivative.
References Forster, M.J. , et al.: J. Computational Chem., 15, 155 (1994),

Formula: C₇H₁₁O₇·Na

Color and Shape: Neat

Molecular weight: 230.148

Ref: TR-M312930