CAS 13436-57-2
:1-(6-nitro-1H-indazol-1-yl)ethanone
Description:
1-(6-nitro-1H-indazol-1-yl)ethanone, with the CAS number 13436-57-2, is a chemical compound characterized by its indazole core, which is substituted with a nitro group at the 6-position and an ethanone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability under standard conditions and potential reactivity due to the presence of the nitro group, which can participate in electrophilic substitution reactions. The nitro group also contributes to the compound's polarity and solubility in various solvents. Additionally, the indazole moiety may impart biological activity, making this compound of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in the development of pharmaceuticals or agrochemicals, although specific biological activities would require further investigation. Safety data and handling precautions should be considered, as nitro compounds can be sensitive and may pose health risks.
Formula:C9H7N3O3
InChI:InChI=1/C9H7N3O3/c1-6(13)11-9-4-8(12(14)15)3-2-7(9)5-10-11/h2-5H,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.