CAS 1344017-76-0
:3-Bromo-α-(5-methyl-2-thienyl)-2-thiophenemethanol
Description:
3-Bromo-α-(5-methyl-2-thienyl)-2-thiophenemethanol is a chemical compound characterized by its unique structure, which includes a bromine atom and multiple thiophene rings. The presence of the bromine substituent suggests that it may exhibit reactivity typical of haloalkanes, potentially participating in nucleophilic substitution reactions. The thiophene rings contribute to the compound's aromaticity, which can influence its electronic properties and stability. Additionally, the methyl group on the thiophene ring may affect the compound's solubility and steric hindrance. This compound may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to the presence of sulfur-containing heterocycles, which are often found in biologically active molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed literature references for precise characterization. Overall, 3-Bromo-α-(5-methyl-2-thienyl)-2-thiophenemethanol represents a complex organic molecule with potential utility in various chemical applications.
Formula:C10H9BrOS2
InChI:InChI=1S/C10H9BrOS2/c1-6-2-3-8(14-6)9(12)10-7(11)4-5-13-10/h2-5,9,12H,1H3
InChI key:InChIKey=LXJMAKCBVAQGNJ-UHFFFAOYSA-N
SMILES:C(O)(C1=C(Br)C=CS1)C=2SC(C)=CC2
Synonyms:- 2-Thiophenemethanol, 3-bromo-α-(5-methyl-2-thienyl)-
- 3-Bromo-α-(5-methyl-2-thienyl)-2-thiophenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.