CymitQuimica logo

CAS 1344045-78-8

:

5-(4-Bromophenyl)-2-chloro-3-pyridinemethanol

Description:
5-(4-Bromophenyl)-2-chloro-3-pyridinemethanol is an organic compound characterized by its complex structure, which includes a pyridine ring substituted with a hydroxymethyl group and halogen atoms. The presence of a bromophenyl group indicates that it has a bromine atom attached to a phenyl ring, contributing to its potential reactivity and biological activity. The chlorine atom in the pyridine ring adds to the compound's electrophilic character, which can influence its interactions in chemical reactions. This compound may exhibit properties such as solubility in polar solvents due to the hydroxymethyl group, while the halogen substituents can enhance its lipophilicity. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such halogenated compounds are often explored for their biological activities. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and chlorine substituents, making it a subject of interest in synthetic organic chemistry.
Formula:C12H9BrClNO
InChI:InChI=1S/C12H9BrClNO/c13-11-3-1-8(2-4-11)9-5-10(7-16)12(14)15-6-9/h1-6,16H,7H2
InChI key:InChIKey=QBWQVIRLERGLTL-UHFFFAOYSA-N
SMILES:C(O)C1=CC(=CN=C1Cl)C2=CC=C(Br)C=C2
Synonyms:
  • 3-Pyridinemethanol, 5-(4-bromophenyl)-2-chloro-
  • 5-(4-Bromophenyl)-2-chloro-3-pyridinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.