
CAS 1344148-47-5
:5-Ethenyl-2-pyridinecarboxaldehyde
Description:
5-Ethenyl-2-pyridinecarboxaldehyde, identified by its CAS number 1344148-47-5, is an organic compound characterized by a pyridine ring substituted with both an ethenyl group and an aldehyde functional group. This compound features a five-membered heterocyclic aromatic structure, which contributes to its chemical reactivity and potential applications in organic synthesis. The presence of the ethenyl group introduces unsaturation, making it a candidate for various addition reactions, while the aldehyde group allows for further functionalization, such as condensation reactions. The compound is likely to exhibit polar characteristics due to the aldehyde group, influencing its solubility in polar solvents. Additionally, its structural features may impart biological activity, making it of interest in medicinal chemistry. Overall, 5-Ethenyl-2-pyridinecarboxaldehyde serves as a versatile building block in the synthesis of more complex organic molecules, with potential applications in pharmaceuticals and agrochemicals.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c1-2-7-3-4-8(6-10)9-5-7/h2-6H,1H2
InChI key:InChIKey=RBALNJXNUMVVNG-UHFFFAOYSA-N
SMILES:C(=C)C=1C=CC(C=O)=NC1
Synonyms:- 2-Pyridinecarboxaldehyde, 5-ethenyl-
- 5-Ethenyl-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.