CAS 134418-28-3: Dehydroandrographolide
Description:Dehydroandrographolide is a natural compound derived from the plant Andrographis paniculata, commonly known for its medicinal properties. It is a bicyclic diterpenoid lactone, characterized by its complex structure that includes multiple rings and functional groups. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and antimicrobial properties, making it of interest in pharmacological research. Dehydroandrographolide has been studied for its potential therapeutic effects in various conditions, including infections and inflammatory diseases. Its mechanism of action often involves modulation of signaling pathways and inhibition of pro-inflammatory cytokines. Additionally, it is known to interact with various biological targets, contributing to its diverse pharmacological effects. The compound is typically analyzed using techniques such as chromatography and spectroscopy to determine its purity and concentration in research settings. Overall, dehydroandrographolide represents a significant area of study in natural product chemistry and drug development, highlighting the importance of plant-derived compounds in modern medicine.
Formula:C20H28O4
InChI:InChI=1S/C20H28O4/c1-13-4-7-16-19(2,10-8-17(22)20(16,3)12-21)15(13)6-5-14-9-11-24-18(14)23/h5,9,11,15-17,21-22H,1,4,6-8,10,12H2,2-3H3/b14-5+/t15-,16-,17+,19-,20-/m0/s1
InChI key:InChIKey=YIIRVUDGRKEWBV-CZUXAOBFSA-N
SMILES:O=C1OC=CC1=CCC2C(=C)CCC3C(C)(CO)C(O)CCC23C
- Synonyms:
- (2R,5R,10R)-2,17-dihydroxy-20-oxo-9,19-didehydro-5,6,7,8,9,10,15-octahydro-20:5,10-dicycloretinal
- (3E)-3-[2-[(1S,4aS,5R,6R,8aS)-Decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethylidene]-2(3H)-furanone
- 14-(P)
- 14-Deoxy-11-dehydroandrographolide
- 2(3H)-Furanone, 3-[2-[(1S,4aS,5R,6R,8aS)-decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethylidene]-, (3E)-
- 2(3H)-Furanone, 3-[2-[decahydro-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-methylene-1-naphthalenyl]ethylidene]-, [1R-[1α,2α,4aα,5β(E),8aβ]]-
- DEOXY-11,12-DiDehydroandrographolide
- Dehydroanddrographolide
- Dehydroandrographoline
- andrographolide, Dehydro-
- See more synonyms
- Dehydroandrographolide