CAS 134419-57-1
:AZETIDINE-2-CARBOXYLIC ACID METHYL ESTER
Description:
Azetidine-2-carboxylic acid methyl ester, with the CAS number 134419-57-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylic acid functional group that is esterified with a methyl group, contributing to its reactivity and solubility properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the azetidine ring imparts unique stereochemical properties, making it of interest in various fields, including medicinal chemistry and organic synthesis. Azetidine derivatives are often studied for their potential biological activities, including antimicrobial and anticancer properties. The methyl ester form enhances its lipophilicity, which can influence its absorption and distribution in biological systems. As with many chemical substances, handling requires appropriate safety measures due to potential toxicity and reactivity. Overall, azetidine-2-carboxylic acid methyl ester serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C5H9NO2
InChI:InChI=1/C5H9NO2/c1-8-5(7)4-2-3-6-4/h4,6H,2-3H2,1H3
SMILES:COC(=O)C1CCN1
Synonyms:- Methyl Azetidine-2-Carboxylate
- Methyl 2-azetidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
