
CAS 1344257-63-1
:1-[2-(Tetrahydro-2H-pyran-2-yl)ethyl]cyclopropanol
Description:
1-[2-(Tetrahydro-2H-pyran-2-yl)ethyl]cyclopropanol is an organic compound characterized by its unique structure, which includes a cyclopropanol moiety and a tetrahydro-2H-pyran substituent. The presence of the cyclopropanol ring imparts distinctive strain and reactivity to the molecule, making it an interesting subject for synthetic and medicinal chemistry. The tetrahydro-2H-pyran group contributes to the compound's overall stability and solubility in organic solvents. This compound may exhibit interesting biological activities due to its structural features, which can influence interactions with biological targets. Additionally, its stereochemistry can play a significant role in its reactivity and potential applications in pharmaceuticals or agrochemicals. The compound's CAS number, 1344257-63-1, allows for easy identification and retrieval of information in chemical databases. Overall, this substance represents a blend of cyclic and acyclic structures, making it a valuable candidate for further research in various chemical fields.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c11-10(6-7-10)5-4-9-3-1-2-8-12-9/h9,11H,1-8H2
InChI key:InChIKey=WQZLRRSBTTVJEI-UHFFFAOYSA-N
SMILES:C(CC1CCCCO1)C2(O)CC2
Synonyms:- Cyclopropanol, 1-[2-(tetrahydro-2H-pyran-2-yl)ethyl]-
- 1-[2-(Tetrahydro-2H-pyran-2-yl)ethyl]cyclopropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.