CAS 13443-46-4
:1,2,3,4,5,6-hexa-O-acetyl-L-iditol
Description:
1,2,3,4,5,6-Hexa-O-acetyl-L-iditol, with the CAS number 13443-46-4, is a chemical compound that belongs to the class of sugar alcohols, specifically a derivative of L-iditol (also known as sorbitol). This compound is characterized by the presence of six acetyl groups attached to the hydroxyl (-OH) groups of the L-iditol backbone, which significantly influences its solubility and reactivity. The acetylation enhances its stability and alters its physical properties, making it more lipophilic compared to its parent compound. Typically, it appears as a white crystalline solid and is soluble in organic solvents. The compound is of interest in various fields, including organic synthesis and carbohydrate chemistry, due to its potential applications in the development of glycosides and other derivatives. Its structural modifications can also affect its biological activity, making it a subject of study in medicinal chemistry. Overall, 1,2,3,4,5,6-hexa-O-acetyl-L-iditol serves as a versatile intermediate in chemical synthesis.
Formula:C18H26O12
InChI:InChI=1/C18H26O12/c1-9(19)25-7-15(27-11(3)21)17(29-13(5)23)18(30-14(6)24)16(28-12(4)22)8-26-10(2)20/h15-18H,7-8H2,1-6H3/t15-,16-,17+,18+/m0/s1
Synonyms:- 13443-46-4
- L-Iditol, hexaacetate
- 1,2,3,4,5,6-Hexa-O-acetyl-l-iditol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
L-Iditol Hexaacetate
CAS:Controlled ProductApplications L-Iditol Hexaacetate (cas# 13443-46-4) is a compound useful in organic synthesis.
Formula:C18H26O12Color and Shape:NeatMolecular weight:434.39
