CAS 134430-93-6
:(R)-(+)-(3,4-Dimethoxy)benzyl-1-phenylethylamine
Description:
(R)-(+)-(3,4-Dimethoxy)benzyl-1-phenylethylamine is a chiral compound characterized by its specific stereochemistry, indicated by the (R)- configuration. This compound features a benzyl group attached to a phenylethylamine backbone, with two methoxy groups located at the 3 and 4 positions on the benzene ring, contributing to its unique electronic and steric properties. The presence of the methoxy groups enhances the lipophilicity of the molecule, potentially influencing its biological activity and solubility in organic solvents. As an amine, it can participate in hydrogen bonding, which may affect its interactions with biological targets. The compound is of interest in medicinal chemistry and pharmacology, particularly for its potential applications in neuropharmacology or as a precursor in the synthesis of other bioactive molecules. Its specific CAS number, 134430-93-6, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status in chemical databases.
Formula:C17H22NO2
InChI:InChI=1/C17H21NO2/c1-13(15-7-5-4-6-8-15)18-12-14-9-10-16(19-2)17(11-14)20-3/h4-11,13,18H,12H2,1-3H3/p+1/t13-/m1/s1
Synonyms:- (-)-(S)-N-(3,4-Dimethoxy)-Benzyl-1-Phenylethylamine
- (+)-(R)-N-(3,4-Dimethoxy)-Benzyl-1-Phenylethylamine
- (S)-N-(3,4-Dimethoxybenzyl)-A-Phenylethy Lamine
- (R)-(+)-(3,4-Dimethoxy)-Benzyl-1-Phenylethylamine 98%
- (S)-N-(3,4-dimethoxybenzyl)-alpha-phenethylamine
- (1R)-N-(3,4-dimethoxybenzyl)-1-phenylethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(R)-(+)-(3,4-Dimethoxy)benzyl-1-phenylethylamine
CAS:Formula:C17H21NO2Color and Shape:SolidMolecular weight:271.3541(R)-N-(3,4-Dimethoxybenzyl)-1-phenylethanamine Hydrochloride
CAS:Controlled ProductFormula:C17H21NO·HClColor and Shape:NeatMolecular weight:271.35(R)-(+)-(3,4-Dimethoxy)benzyl-1-phenylethylamine
CAS:Please enquire for more information about (R)-(+)-(3,4-Dimethoxy)benzyl-1-phenylethylamine including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C17H21NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:271.36 g/mol(R)-N-(3,4-Dimethoxybenzyl)-1-phenylethanamine
CAS:Formula:C17H21NO2Purity:95.0%Molecular weight:271.36





