
CAS 1344306-46-2
:Methyl α-amino-4-chloro-α,γ-dimethyl-1H-pyrazole-1-butanoate
Description:
Methyl α-amino-4-chloro-α,γ-dimethyl-1H-pyrazole-1-butanoate is a chemical compound characterized by its unique structure, which includes a pyrazole ring, a butanoate moiety, and specific substituents that contribute to its biological activity. The presence of the amino group and the chloro substituent on the pyrazole ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as solubility in organic solvents, and its stability can be influenced by environmental factors like pH and temperature. Additionally, the presence of multiple methyl groups can affect its lipophilicity and overall reactivity. As with many pyrazole derivatives, it may possess pharmacological properties, potentially acting as an inhibitor or modulator in various biochemical pathways. However, specific applications and effects would depend on further empirical studies and evaluations. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity.
Formula:C10H16ClN3O2
InChI:InChI=1S/C10H16ClN3O2/c1-7(14-6-8(11)5-13-14)4-10(2,12)9(15)16-3/h5-7H,4,12H2,1-3H3
InChI key:InChIKey=YJXXJPLWKZXLCW-UHFFFAOYSA-N
SMILES:C(CC(C(OC)=O)(C)N)(C)N1C=C(Cl)C=N1
Synonyms:- 1H-Pyrazole-1-butanoic acid, α-amino-4-chloro-α,γ-dimethyl-, methyl ester
- Methyl α-amino-4-chloro-α,γ-dimethyl-1H-pyrazole-1-butanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.