CymitQuimica logo

CAS 134438-26-9

:

dichloro[3-(4-methoxyphenyl)propyl]methylsilane

Description:
Dichloro[3-(4-methoxyphenyl)propyl]methylsilane is an organosilicon compound characterized by the presence of a silicon atom bonded to two chlorine atoms, a methyl group, and a propyl chain that is further substituted with a para-methoxyphenyl group. This compound typically exhibits a clear to pale yellow liquid form at room temperature and is soluble in organic solvents such as dichloromethane and toluene, but may have limited solubility in water due to its hydrophobic nature. The presence of the methoxy group enhances its reactivity and potential applications in organic synthesis, particularly in the formation of siloxane bonds. Additionally, the dichloro substituents can facilitate nucleophilic substitution reactions, making it useful in various chemical transformations. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may be harmful if inhaled or ingested. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of materials science and organic chemistry.
Formula:C11H16Cl2OSi
InChI:InChI=1/C11H16Cl2OSi/c1-14-11-7-5-10(6-8-11)4-3-9-15(2,12)13/h5-8H,3-4,9H2,1-2H3
SMILES:COc1ccc(CCC[Si](C)(Cl)Cl)cc1
Synonyms:
  • 3-(p-Methoxyphenyl)propylmethyldichlorosilane
  • Methoxyphenylpropylmethyldichlorosilane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.