CAS 134448-10-5: L-trans-Epoxysuccinyl-Ile-Pro-OH propylamide
Description:L-trans-Epoxysuccinyl-Ile-Pro-OH propylamide, identified by its CAS number 134448-10-5, is a synthetic compound that belongs to the class of epoxides and amides. This substance is characterized by its unique structural features, including an epoxide group, which contributes to its reactivity and potential biological activity. The presence of the isoleucine and proline residues suggests that it may interact with biological systems, potentially influencing protein synthesis or enzyme activity. Its propylamide moiety may enhance lipophilicity, affecting its solubility and permeability in biological membranes. The compound is likely to exhibit specific stereochemical properties due to the presence of chiral centers, which can influence its pharmacological profile. While detailed information on its biological activity may be limited, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug design. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for reactivity and biological effects.
Formula:C18H29N3O6
InChI:InChI=1/C18H29N3O6/c1-4-8-19-15(22)13-14(27-13)16(23)20-12(10(3)5-2)17(24)21-9-6-7-11(21)18(25)26/h10-14H,4-9H2,1-3H3,(H,19,22)(H,20,23)(H,25,26)
- Synonyms:
- Ca 074
- N-(3-Propylcarbamoyloxirane-2-carbonyl)-isoleucyl-proline
- L-Proline, 1-(N-((3-((propylamino)carbonyl)oxiranyl)carbonyl)-L-isoleucyl)-, (2S-trans)-
- N-{[(3S)-3-(propylcarbamoyl)oxiran-2-yl]carbonyl}-L-isoleucyl-L-proline
- N-{[3-(propylcarbamoyl)oxiran-2-yl]carbonyl}isoleucylproline