CAS 13445-35-7
:2-[(Z)-[(2,6-dimethylphenyl)methylidene](oxido)amino]-N,N-diethylethanamine hydrochloride
Description:
2-[(Z)-[(2,6-dimethylphenyl)methylidene](oxido)amino]-N,N-diethylethanamine hydrochloride, with CAS number 13445-35-7, is a chemical compound characterized by its complex structure, which includes a diethylamino group and a substituted phenyl moiety. This compound features a Z-configured imine linkage, indicating a specific geometric arrangement around the double bond. The presence of an oxido group suggests potential reactivity, particularly in nucleophilic or electrophilic contexts. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound's molecular structure may confer specific biological activities, making it of interest in medicinal chemistry. Its characteristics, such as melting point, solubility, and stability, would depend on the specific conditions and environment in which it is studied. Overall, this compound exemplifies the diversity of organic chemistry and the potential for complex interactions in biological systems.
Formula:C15H25ClN2O
InChI:InChI=1/C15H24N2O.ClH/c1-5-16(6-2)10-11-17(18)12-15-13(3)8-7-9-14(15)4;/h7-9,12H,5-6,10-11H2,1-4H3;1H/b17-12-;
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LM 2510
CAS:<p>LM 2510 is a bioactive chemical.</p>Formula:C15H25ClN2OColor and Shape:SolidMolecular weight:284.83
