CAS 134456-96-5
:N,N′-(4-Hydroxy-2,6-pyridinediyl)bis[acetamide]
Description:
N,N′-(4-Hydroxy-2,6-pyridinediyl)bis[acetamide], with the CAS number 134456-96-5, is a chemical compound characterized by its dual acetamide functional groups linked through a 4-hydroxy-2,6-pyridine moiety. This structure imparts specific properties, such as potential solubility in polar solvents due to the presence of hydroxyl and amide groups, which can engage in hydrogen bonding. The compound may exhibit biological activity, particularly in medicinal chemistry, owing to the pyridine ring's ability to interact with biological targets. Its synthesis typically involves the acylation of a suitable pyridine derivative, and it may be utilized in various applications, including pharmaceuticals and agrochemicals. The presence of the hydroxyl group can enhance its reactivity and influence its interaction with other molecules. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use.
Formula:C9H11N3O3
InChI:InChI=1S/C9H11N3O3/c1-5(13)10-8-3-7(15)4-9(12-8)11-6(2)14/h3-4H,1-2H3,(H3,10,11,12,13,14,15)
InChI key:InChIKey=AXMGBCVBEKISLF-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1N=C(NC(C)=O)C=C(O)C1
Synonyms:- Acetamide, N,N′-(4-hydroxy-2,6-pyridinediyl)bis-
- 2,6-Diacetamido-4-hydroxypyridine
- N,N′-(4-Hydroxy-2,6-pyridinediyl)bis[acetamide]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.