CAS 134457-14-0
:4,4'-bis(bromomethyl)-2,2'-bipyridine
Description:
4,4'-Bis(bromomethyl)-2,2'-bipyridine is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a central carbon atom. This compound features two bromomethyl groups (-CH2Br) attached to the 4-position of each pyridine ring, enhancing its reactivity and potential applications in various chemical reactions, particularly in coordination chemistry. The presence of bromine atoms makes it a suitable candidate for nucleophilic substitution reactions, allowing for the introduction of various functional groups. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows it to act as a ligand in metal coordination complexes, which can be utilized in catalysis and materials science. Additionally, the bromomethyl groups can facilitate further functionalization, making it a versatile building block in organic synthesis. Safety precautions should be taken when handling this compound due to the presence of bromine, which can be hazardous.
Formula:C12H10Br2N2
InChI:InChI=1/C12H10Br2N2/c13-7-9-1-3-15-11(5-9)12-6-10(8-14)2-4-16-12/h1-6H,7-8H2
SMILES:c1cnc(cc1CBr)c1cc(ccn1)CBr
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,4'-Bis(bromomethyl)-2,2'-bipyridine
CAS:Formula:C12H10Br2N2Purity:97%Color and Shape:SolidMolecular weight:342.02924,4'-Bis(bromomethyl)-2,2'-bipyridine
CAS:4,4'-Bis(bromomethyl)-2,2'-bipyridinePurity:98%Molecular weight:342.03g/mol4,4'-Bis(bromomethyl)-2,2'-bipyridine
CAS:4,4'-Bis(bromomethyl)-2,2'-bipyridine is a high quality reagent that has the CAS No. 134457-14-0. It is a complex compound that can be used as an intermediate in the synthesis of other compounds. 4,4'-Bis(bromomethyl)-2,2'-bipyridine is a useful scaffold for the synthesis of novel building blocks and speciality chemicals. It has a variety of uses in research as it can be used as a reaction component or building block to create new molecules with novel properties.Formula:C12H10Br2N2Purity:Min. 95 Area-%Molecular weight:342.03 g/mol4,4'-Bis(bromomethyl)-2,2'-bipyridine
CAS:4,4'-Bis(bromomethyl)-2,2'-bipyridine is a cyclic molecule that can be synthesized by the reaction of 4-bromo-2,2'-bipyridine with a brominating agent. It is used as a precursor to ruthenium catalysts in organic synthesis, and as an additive in dendrimers. The compound has been shown to have light absorption properties and can be used in photovoltaics and electropolymerization.Formula:C12H10N2Br2Purity:Min. 95%Color and Shape:PowderMolecular weight:342.03 g/mol



