CAS 134464-79-2

tert-butyl 4-sulfanylpiperidine-1-carboxylate

Description:

Tert-butyl 4-sulfanylpiperidine-1-carboxylate is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a tert-butyl group and a sulfanyl group. This compound typically exhibits properties common to piperidine derivatives, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is generally soluble in organic solvents, reflecting its hydrophobic tert-butyl group, while the presence of the carboxylate moiety may impart some polar characteristics. The sulfanyl group can influence the compound's reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, compounds of this nature may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological systems. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₉NO₂S

InChI: InChI=1/C10H19NO2S/c1-10(2,3)13-9(12)11-6-4-8(14)5-7-11/h8,14H,4-7H2,1-3H3

SMILES: CC(C)(C)OC(=O)N1CCC(CC1)S

Synonyms:

• tert-Butyl 4-sulfanylpiperidine-1-carboxylate

1-Piperidinecarboxylic acid, 4-mercapto-, 1,1-dimethylethyl ester

CAS: 134464-79-2

Formula: C₁₀H₁₉NO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 217.3284

Ref: IN-DA007ZYM

tert-Butyl 4-sulfanylpiperidine-1-carboxylate

CAS: 134464-79-2

tert-Butyl 4-sulfanylpiperidine-1-carboxylate

Purity: 97%

Molecular weight: 217.33g/mol

Ref: 54-OR1036332

1-Boc-4-Mercapto-piperidine

CAS: 134464-79-2

Formula: C₁₀H₁₉NO₂S

Purity: 97%

Color and Shape: Colourless powder

Molecular weight: 217.33

Ref: 10-F038336