
CAS 1344684-79-2
:2-Chloro-6-fluoro-5-methoxybenzothiazole
Description:
2-Chloro-6-fluoro-5-methoxybenzothiazole is a heterocyclic organic compound characterized by its benzothiazole core, which consists of a benzene ring fused to a thiazole ring. This compound features a chlorine atom at the 2-position, a fluorine atom at the 6-position, and a methoxy group (-OCH3) at the 5-position of the benzothiazole structure. These substituents contribute to its unique chemical properties, including its reactivity and potential biological activity. The presence of halogens (chlorine and fluorine) often enhances lipophilicity and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the methoxy group can affect the compound's solubility and stability. 2-Chloro-6-fluoro-5-methoxybenzothiazole may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample.
Formula:C8H5ClFNOS
InChI:InChI=1S/C8H5ClFNOS/c1-12-6-3-5-7(2-4(6)10)13-8(9)11-5/h2-3H,1H3
InChI key:InChIKey=YFOKOXIRXBOQGF-UHFFFAOYSA-N
SMILES:O(C)C=1C=C2C(=CC1F)SC(Cl)=N2
Synonyms:- Benzothiazole, 2-chloro-6-fluoro-5-methoxy-
- 2-Chloro-6-fluoro-5-methoxybenzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.