CAS 1344687-43-9

Ethyl 5-propoxy-1H-pyrazole-3-carboxylate

Description:

Ethyl 5-propoxy-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an ethyl ester functional group and a propoxy substituent, contributing to its overall reactivity and solubility properties. The presence of the carboxylate group indicates potential for various chemical reactions, including esterification and nucleophilic substitutions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests moderate polarity, which can influence its solubility in organic solvents and water. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as temperature and pH. As with many organic compounds, safety data should be consulted to understand any potential hazards associated with handling and usage. Overall, Ethyl 5-propoxy-1H-pyrazole-3-carboxylate represents a versatile structure with potential applications in various fields, including medicinal chemistry and agrochemicals.

Formula: C₉H₁₄N₂O₃

InChI: InChI=1S/C9H14N2O3/c1-3-5-14-8-6-7(10-11-8)9(12)13-4-2/h6H,3-5H2,1-2H3,(H,10,11)

InChI key: InChIKey=IBJIABOVWQDMGC-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C=C(OCCC)NN1

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 5-propoxy-, ethyl ester
• Ethyl 5-propoxy-1H-pyrazole-3-carboxylate