CymitQuimica logo

CAS 1344687-52-0

:

4-Methyl-5-propoxy-1H-pyrazole-3-carboxylic acid

Description:
4-Methyl-5-propoxy-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a propoxy group, contributing to its unique properties and potential applications. The carboxylic acid functional group indicates that it can participate in acid-base reactions, making it a versatile compound in organic synthesis. Its molecular structure suggests that it may exhibit specific biological activities, potentially making it of interest in pharmaceutical research. The presence of both hydrophobic (propoxy) and hydrophilic (carboxylic acid) groups may influence its solubility and interaction with biological systems. Additionally, the compound's stability, reactivity, and potential for forming derivatives can be explored in various chemical contexts. As with many pyrazole derivatives, it may also possess interesting pharmacological properties, warranting further investigation in medicinal chemistry. Overall, 4-Methyl-5-propoxy-1H-pyrazole-3-carboxylic acid represents a compound with diverse chemical characteristics and potential applications.
Formula:C8H12N2O3
InChI:InChI=1S/C8H12N2O3/c1-3-4-13-7-5(2)6(8(11)12)9-10-7/h3-4H2,1-2H3,(H,9,10)(H,11,12)
InChI key:InChIKey=JXEIKIXQRNZURX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C)=C(OCCC)NN1
Synonyms:
  • 4-Methyl-5-propoxy-1H-pyrazole-3-carboxylic acid
  • 1H-Pyrazole-3-carboxylic acid, 4-methyl-5-propoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.