CymitQuimica logo

CAS 1344687-73-5

:

Ethyl 5-(cyclopentyloxy)-1H-pyrazole-3-carboxylate

Description:
Ethyl 5-(cyclopentyloxy)-1H-pyrazole-3-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the cyclopentyloxy group enhances its structural complexity and may influence its biological activity. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, particularly in the development of new drugs due to their ability to interact with biological targets. The molecular structure suggests that it may exhibit specific properties such as moderate polarity, which can affect its interaction with solvents and biological systems. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds are influenced by the functional groups present. Overall, Ethyl 5-(cyclopentyloxy)-1H-pyrazole-3-carboxylate represents a class of compounds that may hold promise in medicinal chemistry and related fields.
Formula:C11H16N2O3
InChI:InChI=1S/C11H16N2O3/c1-2-15-11(14)9-7-10(13-12-9)16-8-5-3-4-6-8/h7-8H,2-6H2,1H3,(H,12,13)
InChI key:InChIKey=DNNRCYQBNCPSLF-UHFFFAOYSA-N
SMILES:O(C1=CC(C(OCC)=O)=NN1)C2CCCC2
Synonyms:
  • 1H-Pyrazole-3-carboxylic acid, 5-(cyclopentyloxy)-, ethyl ester
  • Ethyl 5-(cyclopentyloxy)-1H-pyrazole-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.