CAS 1344687-96-2

5-(2-Methoxyethoxy)-1-phenyl-1H-pyrazole-3-carboxylic acid

Description:

5-(2-Methoxyethoxy)-1-phenyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a phenyl group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the methoxyethoxy substituent enhances its solubility and may influence its pharmacokinetic properties. Typically, compounds of this nature are investigated for their biological activities, including anti-inflammatory or analgesic effects, due to the presence of the carboxylic acid moiety, which can participate in hydrogen bonding and ionic interactions. The specific arrangement of substituents on the pyrazole ring can significantly affect the compound's reactivity and interaction with biological targets. As with many organic compounds, the stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of pyrazole derivatives that may have applications in medicinal chemistry and drug development.

Formula: C₁₃H₁₄N₂O₄

InChI: InChI=1S/C13H14N2O4/c1-18-7-8-19-12-9-11(13(16)17)14-15(12)10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,16,17)

InChI key: InChIKey=QPVXSLSOPAFYCW-UHFFFAOYSA-N

SMILES: O(CCOC)C=1N(N=C(C(O)=O)C1)C2=CC=CC=C2

Synonyms:

• 5-(2-Methoxyethoxy)-1-phenyl-1H-pyrazole-3-carboxylic acid
• 1H-Pyrazole-3-carboxylic acid, 5-(2-methoxyethoxy)-1-phenyl-