CymitQuimica logo

CAS 1344692-10-9

:

3,4-Dihydro-α-methyl-3-(1-methylethyl)-4-oxo-1-phthalazineacetic acid

Description:
3,4-Dihydro-α-methyl-3-(1-methylethyl)-4-oxo-1-phthalazineacetic acid, identified by its CAS number 1344692-10-9, is a synthetic organic compound that belongs to the class of phthalazine derivatives. This substance features a phthalazine core, which is a bicyclic structure containing two fused aromatic rings, and is characterized by the presence of a ketone group and an acetic acid moiety. The compound exhibits a unique combination of functional groups, including a methyl group and an isopropyl substituent, which contribute to its chemical reactivity and potential biological activity. Its structure suggests that it may possess interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. The compound's solubility, stability, and reactivity can vary depending on environmental conditions, and it may interact with biological systems in specific ways, warranting investigation into its potential applications in drug development or other fields.
Formula:C14H16N2O3
InChI:InChI=1S/C14H16N2O3/c1-8(2)16-13(17)11-7-5-4-6-10(11)12(15-16)9(3)14(18)19/h4-9H,1-3H3,(H,18,19)
InChI key:InChIKey=HDYOOUZOCWAFOS-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)C=1C=2C(C(=O)N(C(C)C)N1)=CC=CC2
Synonyms:
  • 3,4-Dihydro-α-methyl-3-(1-methylethyl)-4-oxo-1-phthalazineacetic acid
  • 1-Phthalazineacetic acid, 3,4-dihydro-α-methyl-3-(1-methylethyl)-4-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.