CymitQuimica logo

CAS 1344692-25-6

:

5-Bromo-2-[(2-fluorophenoxy)methyl]benzoic acid

Description:
5-Bromo-2-[(2-fluorophenoxy)methyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a bromine atom and a fluorophenoxy group attached to a benzoic acid moiety. This compound features a carboxylic acid functional group, which imparts acidic properties, making it soluble in polar solvents. The presence of the bromine and fluorine substituents contributes to its potential reactivity and influences its physical properties, such as melting point and boiling point. The fluorophenoxy group can enhance lipophilicity, potentially affecting the compound's biological activity and interactions with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of new drugs or agrochemicals, due to its unique structural features that could lead to specific biological activities. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and functional group transformations. Overall, 5-Bromo-2-[(2-fluorophenoxy)methyl]benzoic acid represents a versatile building block in organic synthesis and medicinal chemistry.
Formula:C14H10BrFO3
InChI:InChI=1S/C14H10BrFO3/c15-10-6-5-9(11(7-10)14(17)18)8-19-13-4-2-1-3-12(13)16/h1-7H,8H2,(H,17,18)
InChI key:InChIKey=GQTWKUPNSVFYQH-UHFFFAOYSA-N
SMILES:C(OC1=C(F)C=CC=C1)C2=C(C(O)=O)C=C(Br)C=C2
Synonyms:
  • Benzoic acid, 5-bromo-2-[(2-fluorophenoxy)methyl]-
  • 5-Bromo-2-[(2-fluorophenoxy)methyl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.