CAS 134470-38-5
:BW B70C
Description:
BW B70C, with the CAS number 134470-38-5, is a chemical compound primarily recognized for its application in the field of chemical warfare as a potential incapacitating agent. It belongs to a class of compounds known as synthetic opioids, which are designed to affect the central nervous system. The substance is characterized by its potency and ability to induce effects such as sedation, analgesia, and altered mental states. BW B70C is typically classified as a non-lethal agent, intended for use in specific military or law enforcement scenarios. However, due to its potential for misuse and the serious health risks associated with exposure, it is subject to strict regulatory controls. The compound's stability, solubility, and reactivity can vary based on environmental conditions, making it crucial for handling and storage to be conducted with caution. Overall, BW B70C exemplifies the complexities and ethical considerations surrounding the development and use of chemical agents in various contexts.
Formula:C17H17FN2O3
InChI:InChI=1/C17H17FN2O3/c1-12(20(22)17(19)21)5-6-13-3-2-4-16(11-13)23-15-9-7-14(18)8-10-15/h2-12,22H,1H3,(H2,19,21)/b6-5+
InChI key:InChIKey=UAIYNMRLUHHRMF-UHFFFAOYSA-N
SMILES:O(C1=CC(C=CC(N(C(N)=O)O)C)=CC=C1)C2=CC=C(F)C=C2
Synonyms:- (E)-N-(3-(3-(4-Fluorophenoxy)Phenyl)-1-(R,S)-Methylprop-2-Enyl)-N-Hydroxyure
- 1-{(2E)-3-[3-(4-fluorophenoxy)phenyl]-1-methylprop-2-en-1-yl}-1-hydroxyurea
- 70c
- Bw-B 70C
- N-(3-(3-(4-Fluorophenoxy)Phenyl)-1-Methyl-2-Propenyl)-N-Hydroxy-Ure
- N-[3-[3-(-Fluorophenoxy)Phenyl]-1-Methyl-2-Propenyl]-N-Hydroxyurea
- N-[3-[3-(4-Fluorophenoxy)phenyl]-1-methyl-2-propen-1-yl]-N-hydroxyurea
- N-[3-[3-4(-Fluorophenoxy)Phenyl]-1-Methyl-2-Propenyl]-N-Hydroxyurea
- Urea, N-[3-[3-(4-fluorophenoxy)phenyl]-1-methyl-2-propen-1-yl]-N-hydroxy-
- Urea, N-[3-[3-(4-fluorophenoxy)phenyl]-1-methyl-2-propenyl]-N-hydroxy-
- BW B70C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
BW B70C
CAS:Controlled ProductApplications BW B70C is a 5-LO (5-lipoxygenase) inhibitor.
References Averina, E.B., et al.: Bioorg. Med. Chem, 24, 712 (2016)Formula:C17H17FN2O3Color and Shape:NeatMolecular weight:316.327

