CymitQuimica logo

CAS 1344704-23-9

:

N-Ethyl-5-methoxy-1,2-benzisoxazol-3-amine

Description:
N-Ethyl-5-methoxy-1,2-benzisoxazol-3-amine is a chemical compound characterized by its unique structural features, which include a benzisoxazole ring system and an ethyl amine substituent. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its interaction with biological membranes and receptors. As a member of the benzisoxazole family, it may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential for various applications, including in the fields of neuroscience and pharmacology, where it may act as a modulator of neurotransmitter systems. However, specific data regarding its solubility, stability, and reactivity would require empirical investigation. Overall, N-Ethyl-5-methoxy-1,2-benzisoxazol-3-amine represents a compound with intriguing characteristics that warrant further exploration in scientific research.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-3-11-10-8-6-7(13-2)4-5-9(8)14-12-10/h4-6H,3H2,1-2H3,(H,11,12)
InChI key:InChIKey=BAXFMYUBWADCFS-UHFFFAOYSA-N
SMILES:N(CC)C=1C=2C(ON1)=CC=C(OC)C2
Synonyms:
  • 1,2-Benzisoxazol-3-amine, N-ethyl-5-methoxy-
  • N-Ethyl-5-methoxy-1,2-benzisoxazol-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.