CAS 134524-84-8: Dichloro[(S)-(-)-,2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium (II)
Description:Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II), commonly referred to as Ru(bisphosphine), is a chiral ruthenium complex notable for its application in asymmetric catalysis. This compound features a ruthenium center coordinated to two chloride ions and a bidentate ligand, which is a bisphosphine derived from binaphthyl. The presence of the chiral binaphthyl backbone imparts stereochemical properties that are crucial for catalyzing reactions with high enantioselectivity. The complex is typically characterized by its stability and ability to facilitate various organic transformations, including hydrogenation and cross-coupling reactions. Its solubility in organic solvents makes it versatile for use in synthetic chemistry. Additionally, the compound's chirality allows it to be employed in the synthesis of enantiomerically pure compounds, which is highly valuable in pharmaceuticals and fine chemicals. Overall, this ruthenium complex exemplifies the intersection of coordination chemistry and catalysis, showcasing the importance of metal-ligand interactions in promoting specific chemical reactivity.
Formula:C44H32Cl2P2Ru
InChI:InChI=1/C44H32P2.2ClH.Ru/c1-5-19-35(20-6-1)45(36-21-7-2-8-22-36)41-31-29-33-17-13-15-27-39(33)43(41)44-40-28-16-14-18-34(40)30-32-42(44)46(37-23-9-3-10-24-37)38-25-11-4-12-26-38;;;/h1-32H;2*1H;/q;;;+2/p-2
- Synonyms:
- Dichlorobisdiphenylphosphinobinaphthylrutheniu
- [(S)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II) Dichloride
- Dichloro[(R)-(+)-2,2'-Bis(Diphenylphosphino)-1,1'-Binaphthyl]Ruthenium (Ii)
- (S-BINAP)RuCl2
- Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II)
- Dichloro[(S)-(+)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II)

Dichloro[(S)-(-)-2,2'-bis(diphenylphosphino)-1,1'-binaphthyl]ruthenium(II), min. 95%
Ref: 08-44-0249
2g | 540.00 € | ||
100mg | 89.00 € | ||
500mg | 189.00 € |

DICHLORO[(R)-(+)-2,2'-BIS(DIPHENYLPHOSPHINO)-1,1'-BINAPHTHYL]RUTHENIUM (II)
Ref: IN-DA009AJH
1g | 95.00 € | ||
5g | 274.00 € | ||
25g | To inquire | ||
100mg | 45.00 € | ||
250mg | 47.00 € |

Dichloro-R-2,2?-Bis(Diphenylphosphino)-1,1?-Binaphthyl Ruthenium
Ref: 54-OR1012845
1g | 76.00 € | ||
5g | 285.00 € | ||
25g | 1,218.00 € | ||
250mg | 32.00 € |

[(S)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]dichlororuthenium
Controlled ProductRef: TR-B430400
1g | 469.00 € | ||
100mg | 107.00 € | ||
250mg | 152.00 € |

(S)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]dichlororuthenium
Ref: 3D-FB175720
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information |