CAS 134538-48-0

2-[(1E)-2-nitroprop-1-en-1-yl]furan

Description:

2-[(1E)-2-nitroprop-1-en-1-yl]furan is an organic compound characterized by its furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of a nitro group and a prop-1-en-1-yl substituent indicates that this compound has both electron-withdrawing and electron-donating characteristics, which can influence its reactivity and stability. The nitro group typically enhances the compound's electrophilic nature, making it more reactive in various chemical reactions, such as nucleophilic substitutions or reductions. The furan moiety contributes to the compound's aromaticity, which can affect its solubility and interaction with other molecules. This compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular structure and intermolecular interactions. Overall, 2-[(1E)-2-nitroprop-1-en-1-yl]furan represents a unique structure with potential applications in various chemical and pharmaceutical fields.

Formula: C₇H₇NO₃

InChI: InChI=1/C7H7NO3/c1-6(8(9)10)5-7-3-2-4-11-7/h2-5H,1H3/b6-5+

Synonyms:

• 2-(2-Nitro-1-Propenyl)Furan
• 2-(2-Nitropropenyl)furan
• 2-[(1E)-2-Nitro-1-propen-1-yl]furan
• Furan, 2- (2-nitro-1-propenyl)-
• Furan, 2- (2-nitropropenyl)-
• furan, 2-[(1E)-2-nitro-1-propen-1-yl]-