CAS 1345471-19-3
:6-Bromo-3,4-dihydro-3-methyl-2H-1,5-benzodioxepin
Description:
6-Bromo-3,4-dihydro-3-methyl-2H-1,5-benzodioxepin is a chemical compound characterized by its unique bicyclic structure, which incorporates a benzodioxepin moiety. This compound features a bromine atom at the 6-position and a methyl group at the 3-position, contributing to its distinct chemical properties. The presence of the bromine atom can enhance the compound's reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The dihydro configuration indicates that the compound has a saturated ring system, which may influence its physical properties, such as solubility and boiling point. Additionally, the benzodioxepin framework is known for its potential biological activity, which may include effects on neurotransmitter systems or other pharmacological targets. Overall, 6-Bromo-3,4-dihydro-3-methyl-2H-1,5-benzodioxepin represents a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H11BrO2
InChI:InChI=1S/C10H11BrO2/c1-7-5-12-9-4-2-3-8(11)10(9)13-6-7/h2-4,7H,5-6H2,1H3
InChI key:InChIKey=SVQYBLHUCPEMDG-UHFFFAOYSA-N
SMILES:BrC1=C2C(OCC(C)CO2)=CC=C1
Synonyms:- 6-Bromo-3,4-dihydro-3-methyl-2H-1,5-benzodioxepin
- 2H-1,5-Benzodioxepin, 6-bromo-3,4-dihydro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.