CAS 1345471-25-1

3-[[5-Bromo-2-chloro-4-(trifluoromethyl)phenoxy]methyl]pyridine

Description:

3-[[5-Bromo-2-chloro-4-(trifluoromethyl)phenoxy]methyl]pyridine, identified by its CAS number 1345471-25-1, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a phenoxy group substituted with bromine, chlorine, and trifluoromethyl groups. This compound typically exhibits properties associated with halogenated aromatic compounds, such as increased lipophilicity and potential biological activity. The presence of the trifluoromethyl group often enhances the compound's stability and alters its electronic properties, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the bromine and chlorine substituents can influence the compound's reactivity and interaction with biological targets. As with many halogenated compounds, it may exhibit specific environmental persistence and toxicity profiles, necessitating careful handling and assessment in research and application contexts. Overall, this compound's unique structural features contribute to its potential utility in chemical synthesis and biological research.

Formula: C₁₃H₈BrClF₃NO

InChI: InChI=1S/C13H8BrClF3NO/c14-10-5-12(11(15)4-9(10)13(16,17)18)20-7-8-2-1-3-19-6-8/h1-6H,7H2

InChI key: InChIKey=ABRUIRMIPAJSKB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(Br)C=C(OCC=2C=CC=NC2)C(Cl)=C1

Synonyms:

• 3-[[5-Bromo-2-chloro-4-(trifluoromethyl)phenoxy]methyl]pyridine
• Pyridine, 3-[[5-bromo-2-chloro-4-(trifluoromethyl)phenoxy]methyl]-

2-Bromo-5-chloro-4-(pyridin-3-ylmethyl)benzotrifluoride

CAS: 1345471-25-1

Formula: C₁₃H₈BrClF₃NO

Molecular weight: 366.5609

Ref: IN-DA009WW5